C15H23ClN2 — CID 142350924
4-(2-chloro-4,6-dimethylphenyl)-1,2,6-trimethylpiperazine (PubChem CID 142350924) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 4-(2-chloro-4,6-dimethylphenyl)-1,2,6-trimethylpiperazine.
| Compound Name | 4-(2-chloro-4,6-dimethylphenyl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 142350924 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(2-chloro-4,6-dimethylphenyl)-1,2,6-trimethylpiperazine |
| SMILES | Cc1cc(C)c(N2CC(C)N(C)C(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2/c1-10-6-11(2)15(14(16)7-10)18-8-12(3)17(5)13(4)9-18/h6-7,12-13H,8-9H2,1-5H3 |
| InChIKey | VXULTTIIUBINPM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |