C23H33AlN2 — CID 134946832
4,6-dimethyl-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazaluminane (PubChem CID 134946832) has the molecular formula C23H33AlN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazaluminane.
| Compound Name | 4,6-dimethyl-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazaluminane |
|---|---|
| PubChem CID | 134946832 |
| Molecular Formula | C23H33AlN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 4,6-dimethyl-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazaluminane |
| SMILES | Cc1cc(C)c(N2[AlH]N(c3c(C)cc(C)cc3C)C(C)CC2C)c(C)c1 |
| InChI | InChI=1S/C23H32N2.Al.H/c1-14-9-16(3)22(17(4)10-14)24-20(7)13-21(8)25-23-18(5)11-15(2)12-19(23)6;;/h9-12,20-21H,13H2,1-8H3;;/q-2;+2; |
| InChIKey | UKYIKIXKDLATBA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |