About CID 101475276
CID 101475276 (PubChem CID 101475276) has the molecular formula C21H27BrCuN2
and a molecular weight of 450.91 g/mol.
Molecular Properties
| Compound Name | CID 101475276 |
| PubChem CID | 101475276 |
| Molecular Formula | C21H27BrCuN2 |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[CH]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.[Br-].[Cu+] |
| InChI | InChI=1S/C21H27N2.BrH.Cu/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;/h9-13H,7-8H2,1-6H3;1H;/q;;+1/p-1 |
| InChIKey | VOBSQJJUMNGITO-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101475276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101475276?
The IUPAC name of CID 101475276 (CID 101475276) is not available.
What is the SMILES notation for CID 101475276?
The canonical SMILES for CID 101475276 is Cc1cc(C)c(N2[CH]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.[Br-].[Cu+].
What is the InChIKey of CID 101475276?
The InChIKey is VOBSQJJUMNGITO-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H27N2.BrH.Cu/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;/h9-13H,7-8H2,1-6H3;1H;/q;;+1/p-1.
What are the key properties of CID 101475276?
CID 101475276 has a molecular weight of 450.91 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101475276 is sourced from PubChem (CID 101475276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).