C26H37N3 — CID 22600180
1-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]piperidine (PubChem CID 22600180) has the molecular formula C26H37N3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 1-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]piperidine.
| Compound Name | 1-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]piperidine |
|---|---|
| PubChem CID | 22600180 |
| Molecular Formula | C26H37N3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | 1-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]piperidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2N2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C26H37N3/c1-18-14-20(3)24(21(4)15-18)28-12-13-29(26(28)27-10-8-7-9-11-27)25-22(5)16-19(2)17-23(25)6/h14-17,26H,7-13H2,1-6H3 |
| InChIKey | OCGDTCCJVRHCSD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |