C39H59N2P — CID 87699138
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-tricyclohexyl-λ5-phosphane (PubChem CID 87699138) has the molecular formula C39H59N2P and a molecular weight of 586.89 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-tricyclohexyl-λ5-phosphane.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-tricyclohexyl-λ5-phosphane |
|---|---|
| PubChem CID | 87699138 |
| Molecular Formula | C39H59N2P |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-tricyclohexyl-λ5-phosphane |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=P(C2CCCCC2)(C2CCCCC2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C39H59N2P/c1-28-24-30(3)37(31(4)25-28)40-22-23-41(38-32(5)26-29(2)27-33(38)6)39(40)42(34-16-10-7-11-17-34,35-18-12-8-13-19-35)36-20-14-9-15-21-36/h24-27,34-36H,7-23H2,1-6H3 |
| InChIKey | RQYWBVSUIYPXCT-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|