C23H26F4N2 — CID 132850287
2-(1,2,2,2-tetrafluoroethylidene)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 132850287) has the molecular formula C23H26F4N2 and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-(1,2,2,2-tetrafluoroethylidene)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 2-(1,2,2,2-tetrafluoroethylidene)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 132850287 |
| Molecular Formula | C23H26F4N2 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-(1,2,2,2-tetrafluoroethylidene)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=C(F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C23H26F4N2/c1-13-9-15(3)19(16(4)10-13)28-7-8-29(22(28)21(24)23(25,26)27)20-17(5)11-14(2)12-18(20)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | WLQCEDVBCTWNGY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |