C21H28N3+ — CID 102142824
1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-amine (PubChem CID 102142824) has the molecular formula C21H28N3+ and a molecular weight of 322.48 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-amine.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 102142824 |
| Molecular Formula | C21H28N3+ |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-amine |
| SMILES | Cc1cc(C)c(N2CC[N+](c3c(C)cc(C)cc3C)=C2N)c(C)c1 |
| InChI | InChI=1S/C21H27N3/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22)20-17(5)11-14(2)12-18(20)6/h9-12,22H,7-8H2,1-6H3/p+1 |
| InChIKey | GOQYWHJYKYNMAH-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|