C21H26AgClN2 — CID 139105916
silver;1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-2H-imidazol-1-ium-2-ide;chloride (PubChem CID 139105916) has the molecular formula C21H26AgClN2 and a molecular weight of 449.77 g/mol. Its IUPAC name is silver;1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-2H-imidazol-1-ium-2-ide;chloride.
| Compound Name | silver;1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-2H-imidazol-1-ium-2-ide;chloride |
|---|---|
| PubChem CID | 139105916 |
| Molecular Formula | C21H26AgClN2 |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | silver;1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-2H-imidazol-1-ium-2-ide;chloride |
| SMILES | Cc1cc(C)c(N2[C-]=[N+](c3c(C)cc(C)cc3C)CC2)c(C)c1.[Ag+].[Cl-] |
| InChI | InChI=1S/C21H26N2.Ag.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;/h9-12H,7-8H2,1-6H3;;1H/q;+1;/p-1 |
| InChIKey | GILPVRLOPDIQQP-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|