C21H22Cl4N2 — CID 11037611
2,4,5-trichloro-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride (PubChem CID 11037611) has the molecular formula C21H22Cl4N2 and a molecular weight of 444.23 g/mol. Its IUPAC name is 2,4,5-trichloro-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride.
| Compound Name | 2,4,5-trichloro-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride |
|---|---|
| PubChem CID | 11037611 |
| Molecular Formula | C21H22Cl4N2 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2,4,5-trichloro-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride |
| SMILES | Cc1cc(C)c(-n2c(Cl)c(Cl)[n+](-c3c(C)cc(C)cc3C)c2Cl)c(C)c1.[Cl-] |
| InChI | InChI=1S/C21H22Cl3N2.ClH/c1-11-7-13(3)17(14(4)8-11)25-19(22)20(23)26(21(25)24)18-15(5)9-12(2)10-16(18)6;/h7-10H,1-6H3;1H/q+1;/p-1 |
| InChIKey | BJWIUXPFRCLHDV-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|