C21H22Br2N2 — CID 139175317
4,5-dibromo-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide (PubChem CID 139175317) has the molecular formula C21H22Br2N2 and a molecular weight of 462.23 g/mol. Its IUPAC name is 4,5-dibromo-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide.
| Compound Name | 4,5-dibromo-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 139175317 |
| Molecular Formula | C21H22Br2N2 |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 4,5-dibromo-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1cc(C)c(-n2[c-][n+](-c3c(C)cc(C)cc3C)c(Br)c2Br)c(C)c1 |
| InChI | InChI=1S/C21H22Br2N2/c1-12-7-14(3)18(15(4)8-12)24-11-25(21(23)20(24)22)19-16(5)9-13(2)10-17(19)6/h7-10H,1-6H3 |
| InChIKey | FPBCKOYUJFDKAO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|