C22H27N2O+ — CID 177430023
5-methyl-1,3-bis(2,4,6-trimethylphenyl)imidazol-3-ium-4-ol (PubChem CID 177430023) has the molecular formula C22H27N2O+ and a molecular weight of 335.47 g/mol. Its IUPAC name is 5-methyl-1,3-bis(2,4,6-trimethylphenyl)imidazol-3-ium-4-ol.
| Compound Name | 5-methyl-1,3-bis(2,4,6-trimethylphenyl)imidazol-3-ium-4-ol |
|---|---|
| PubChem CID | 177430023 |
| Molecular Formula | C22H27N2O+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 5-methyl-1,3-bis(2,4,6-trimethylphenyl)imidazol-3-ium-4-ol |
| SMILES | Cc1cc(C)c(-n2c[n+](-c3c(C)cc(C)cc3C)c(O)c2C)c(C)c1 |
| InChI | InChI=1S/C22H26N2O/c1-13-8-15(3)20(16(4)9-13)23-12-24(22(25)19(23)7)21-17(5)10-14(2)11-18(21)6/h8-12H,1-7H3/p+1 |
| InChIKey | PPIZBMBZGGEEAM-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|