C42H48N4P+ — CID 102349812
[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]phosphane (PubChem CID 102349812) has the molecular formula C42H48N4P+ and a molecular weight of 639.85 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]phosphane.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]phosphane |
|---|---|
| PubChem CID | 102349812 |
| Molecular Formula | C42H48N4P+ |
| Molecular Weight | 639.85 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]phosphane |
| SMILES | Cc1cc(C)c(-n2cc[n+](-c3c(C)cc(C)cc3C)c2P=c2n(-c3c(C)cc(C)cc3C)ccn2-c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C42H48N4P/c1-25-17-29(5)37(30(6)18-25)43-13-14-44(38-31(7)19-26(2)20-32(38)8)41(43)47-42-45(39-33(9)21-27(3)22-34(39)10)15-16-46(42)40-35(11)23-28(4)24-36(40)12/h13-24H,1-12H3/q+1 |
| InChIKey | BLAAPPNYDDKOPS-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 18.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.85 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|