C30H35N2O2+ — CID 134949354
[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-cyclohexa-2,4-dien-1-yl-ethenoxymethanol (PubChem CID 134949354) has the molecular formula C30H35N2O2+ and a molecular weight of 455.62 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-cyclohexa-2,4-dien-1-yl-ethenoxymethanol.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-cyclohexa-2,4-dien-1-yl-ethenoxymethanol |
|---|---|
| PubChem CID | 134949354 |
| Molecular Formula | C30H35N2O2+ |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-cyclohexa-2,4-dien-1-yl-ethenoxymethanol |
| SMILES | C=COC(O)(c1n(-c2c(C)cc(C)cc2C)cc[n+]1-c1c(C)cc(C)cc1C)C1C=CC=CC1 |
| InChI | InChI=1S/C30H35N2O2/c1-8-34-30(33,26-12-10-9-11-13-26)29-31(27-22(4)16-20(2)17-23(27)5)14-15-32(29)28-24(6)18-21(3)19-25(28)7/h8-12,14-19,26,33H,1,13H2,2-7H3/q+1 |
| InChIKey | BYYTUSNSUULNIE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|