C24H41BN2O — CID 177484298
triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]boranuide (PubChem CID 177484298) has the molecular formula C24H41BN2O and a molecular weight of 384.42 g/mol. Its IUPAC name is triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]boranuide.
| Compound Name | triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]boranuide |
|---|---|
| PubChem CID | 177484298 |
| Molecular Formula | C24H41BN2O |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.33 |
| IUPAC Name | triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]boranuide |
| SMILES | CC[B-](CC)(CC)c1n(-c2c(C)cc(C)cc2C)cc[n+]1CC(O)C(C)(C)C |
| InChI | InChI=1S/C24H41BN2O/c1-10-25(11-2,12-3)23-26(17-21(28)24(7,8)9)13-14-27(23)22-19(5)15-18(4)16-20(22)6/h13-16,21,28H,10-12,17H2,1-9H3 |
| InChIKey | XJZHAZMZEHCNAD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|