C9H14O3P+ — CID 67570561
trihydroxy-(2,4,6-trimethylphenyl)phosphanium (PubChem CID 67570561) has the molecular formula C9H14O3P+ and a molecular weight of 201.18 g/mol. Its IUPAC name is trihydroxy-(2,4,6-trimethylphenyl)phosphanium.
| Compound Name | trihydroxy-(2,4,6-trimethylphenyl)phosphanium |
|---|---|
| PubChem CID | 67570561 |
| Molecular Formula | C9H14O3P+ |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | trihydroxy-(2,4,6-trimethylphenyl)phosphanium |
| SMILES | Cc1cc(C)c([P+](O)(O)O)c(C)c1 |
| InChI | InChI=1S/C9H14O3P/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5,10-12H,1-3H3/q+1 |
| InChIKey | AUDSWLZDFFOYJD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|