About CID 56621266
CID 56621266 (PubChem CID 56621266) has the molecular formula C10H13O3P
and a molecular weight of 212.19 g/mol.
Molecular Properties
| Compound Name | CID 56621266 |
| PubChem CID | 56621266 |
| Molecular Formula | C10H13O3P |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(C(O)P(=O)=O)c(C)c1 |
| InChI | InChI=1S/C10H13O3P/c1-6-4-7(2)9(8(3)5-6)10(11)14(12)13/h4-5,10-11H,1-3H3 |
| InChIKey | YCHGAYLUBPGJAB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 56621266 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56621266?
The IUPAC name of CID 56621266 (CID 56621266) is not available.
What is the SMILES notation for CID 56621266?
The canonical SMILES for CID 56621266 is Cc1cc(C)c(C(O)P(=O)=O)c(C)c1.
What is the InChIKey of CID 56621266?
The InChIKey is YCHGAYLUBPGJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O3P/c1-6-4-7(2)9(8(3)5-6)10(11)14(12)13/h4-5,10-11H,1-3H3.
What are the key properties of CID 56621266?
CID 56621266 has a molecular weight of 212.19 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56621266 is sourced from PubChem (CID 56621266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).