C11H15NO3 — CID 102401511
2-nitro-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 102401511) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-nitro-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 2-nitro-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 102401511 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-nitro-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(O)C[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C11H15NO3/c1-7-4-8(2)11(9(3)5-7)10(13)6-12(14)15/h4-5,10,13H,6H2,1-3H3 |
| InChIKey | NHUJXLRKBJJRIM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|