C14H15NO4 — CID 61087360
(5-nitrofuran-2-yl)-(2,4,6-trimethylphenyl)methanol (PubChem CID 61087360) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)-(2,4,6-trimethylphenyl)methanol.
| Compound Name | (5-nitrofuran-2-yl)-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 61087360 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (5-nitrofuran-2-yl)-(2,4,6-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ccc([N+](=O)[O-])o2)c(C)c1 |
| InChI | InChI=1S/C14H15NO4/c1-8-6-9(2)13(10(3)7-8)14(16)11-4-5-12(19-11)15(17)18/h4-7,14,16H,1-3H3 |
| InChIKey | XAQUJBLXRAFSTI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|