C11H10BrNO3S — CID 61098950
2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]-5-nitrofuran (PubChem CID 61098950) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]-5-nitrofuran.
| Compound Name | 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]-5-nitrofuran |
|---|---|
| PubChem CID | 61098950 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]-5-nitrofuran |
| SMILES | Cc1cc(C(Br)c2ccc([N+](=O)[O-])o2)c(C)s1 |
| InChI | InChI=1S/C11H10BrNO3S/c1-6-5-8(7(2)17-6)11(12)9-3-4-10(16-9)13(14)15/h3-5,11H,1-2H3 |
| InChIKey | FYWVRIOXNXNRAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|