C13H12BrNO5 — CID 61095917
2-[bromo-(2,4-dimethoxyphenyl)methyl]-5-nitrofuran (PubChem CID 61095917) has the molecular formula C13H12BrNO5 and a molecular weight of 342.15 g/mol. Its IUPAC name is 2-[bromo-(2,4-dimethoxyphenyl)methyl]-5-nitrofuran.
| Compound Name | 2-[bromo-(2,4-dimethoxyphenyl)methyl]-5-nitrofuran |
|---|---|
| PubChem CID | 61095917 |
| Molecular Formula | C13H12BrNO5 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-[bromo-(2,4-dimethoxyphenyl)methyl]-5-nitrofuran |
| SMILES | COc1ccc(C(Br)c2ccc([N+](=O)[O-])o2)c(OC)c1 |
| InChI | InChI=1S/C13H12BrNO5/c1-18-8-3-4-9(11(7-8)19-2)13(14)10-5-6-12(20-10)15(16)17/h3-7,13H,1-2H3 |
| InChIKey | RAZXOFHGYIHKPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|