C13H13NO6 — CID 61087514
(2,4-dimethoxyphenyl)-(5-nitrofuran-2-yl)methanol (PubChem CID 61087514) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(5-nitrofuran-2-yl)methanol.
| Compound Name | (2,4-dimethoxyphenyl)-(5-nitrofuran-2-yl)methanol |
|---|---|
| PubChem CID | 61087514 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(5-nitrofuran-2-yl)methanol |
| SMILES | COc1ccc(C(O)c2ccc([N+](=O)[O-])o2)c(OC)c1 |
| InChI | InChI=1S/C13H13NO6/c1-18-8-3-4-9(11(7-8)19-2)13(15)10-5-6-12(20-10)14(16)17/h3-7,13,15H,1-2H3 |
| InChIKey | ACGGRQNUWFOXJC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|