C11H11BrOS — CID 61098751
2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]furan (PubChem CID 61098751) has the molecular formula C11H11BrOS and a molecular weight of 271.18 g/mol. Its IUPAC name is 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]furan.
| Compound Name | 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]furan |
|---|---|
| PubChem CID | 61098751 |
| Molecular Formula | C11H11BrOS |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 2-[bromo-(2,5-dimethylthiophen-3-yl)methyl]furan |
| SMILES | Cc1cc(C(Br)c2ccco2)c(C)s1 |
| InChI | InChI=1S/C11H11BrOS/c1-7-6-9(8(2)14-7)11(12)10-4-3-5-13-10/h3-6,11H,1-2H3 |
| InChIKey | SMJNSNIWOBKEHV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|