C14H15BrO3 — CID 61096008
2-[bromo-(4,5-dimethoxy-2-methylphenyl)methyl]furan (PubChem CID 61096008) has the molecular formula C14H15BrO3 and a molecular weight of 311.18 g/mol. Its IUPAC name is 2-[bromo-(4,5-dimethoxy-2-methylphenyl)methyl]furan.
| Compound Name | 2-[bromo-(4,5-dimethoxy-2-methylphenyl)methyl]furan |
|---|---|
| PubChem CID | 61096008 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[bromo-(4,5-dimethoxy-2-methylphenyl)methyl]furan |
| SMILES | COc1cc(C)c(C(Br)c2ccco2)cc1OC |
| InChI | InChI=1S/C14H15BrO3/c1-9-7-12(16-2)13(17-3)8-10(9)14(15)11-5-4-6-18-11/h4-8,14H,1-3H3 |
| InChIKey | TVBJEGNVFRTZLC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|