C12H17BrO2 — CID 61097408
1-(1-bromopropyl)-4,5-dimethoxy-2-methylbenzene (PubChem CID 61097408) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-(1-bromopropyl)-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-(1-bromopropyl)-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 61097408 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-(1-bromopropyl)-4,5-dimethoxy-2-methylbenzene |
| SMILES | CCC(Br)c1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C12H17BrO2/c1-5-10(13)9-7-12(15-4)11(14-3)6-8(9)2/h6-7,10H,5H2,1-4H3 |
| InChIKey | JVDWJYFOZULTEN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|