C13H20O — CID 144980692
1-butan-2-yl-5-methoxy-2,4-dimethylbenzene (PubChem CID 144980692) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-butan-2-yl-5-methoxy-2,4-dimethylbenzene.
| Compound Name | 1-butan-2-yl-5-methoxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 144980692 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-butan-2-yl-5-methoxy-2,4-dimethylbenzene |
| SMILES | CCC(C)c1cc(OC)c(C)cc1C |
| InChI | InChI=1S/C13H20O/c1-6-9(2)12-8-13(14-5)11(4)7-10(12)3/h7-9H,6H2,1-5H3 |
| InChIKey | AASYQUPSNVDNBJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |