C13H20O2 — CID 82077691
2-(4-methoxy-2,5-dimethylphenyl)butan-1-ol (PubChem CID 82077691) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(4-methoxy-2,5-dimethylphenyl)butan-1-ol.
| Compound Name | 2-(4-methoxy-2,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 82077691 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(4-methoxy-2,5-dimethylphenyl)butan-1-ol |
| SMILES | CCC(CO)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C13H20O2/c1-5-11(8-14)12-6-10(3)13(15-4)7-9(12)2/h6-7,11,14H,5,8H2,1-4H3 |
| InChIKey | RLQHXUSFXGOPBI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |