C12H19NO2 — CID 82283929
3-amino-2-(2-methoxy-4,5-dimethylphenyl)propan-1-ol (PubChem CID 82283929) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-amino-2-(2-methoxy-4,5-dimethylphenyl)propan-1-ol.
| Compound Name | 3-amino-2-(2-methoxy-4,5-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82283929 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-amino-2-(2-methoxy-4,5-dimethylphenyl)propan-1-ol |
| SMILES | COc1cc(C)c(C)cc1C(CN)CO |
| InChI | InChI=1S/C12H19NO2/c1-8-4-11(10(6-13)7-14)12(15-3)5-9(8)2/h4-5,10,14H,6-7,13H2,1-3H3 |
| InChIKey | PWDIVXABXNTZFP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |