C13H11Br2FS — CID 107958748
3-[bromo-(3-bromo-2-fluorophenyl)methyl]-2,5-dimethylthiophene (PubChem CID 107958748) has the molecular formula C13H11Br2FS and a molecular weight of 378.10 g/mol. Its IUPAC name is 3-[bromo-(3-bromo-2-fluorophenyl)methyl]-2,5-dimethylthiophene.
| Compound Name | 3-[bromo-(3-bromo-2-fluorophenyl)methyl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 107958748 |
| Molecular Formula | C13H11Br2FS |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | 3-[bromo-(3-bromo-2-fluorophenyl)methyl]-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Br)c2cccc(Br)c2F)c(C)s1 |
| InChI | InChI=1S/C13H11Br2FS/c1-7-6-10(8(2)17-7)12(15)9-4-3-5-11(14)13(9)16/h3-6,12H,1-2H3 |
| InChIKey | ULMGIEJWZIQPSJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|