C13H7Br4F — CID 107958201
1,4-dibromo-2-[bromo-(3-bromo-2-fluorophenyl)methyl]benzene (PubChem CID 107958201) has the molecular formula C13H7Br4F and a molecular weight of 501.81 g/mol. Its IUPAC name is 1,4-dibromo-2-[bromo-(3-bromo-2-fluorophenyl)methyl]benzene.
| Compound Name | 1,4-dibromo-2-[bromo-(3-bromo-2-fluorophenyl)methyl]benzene |
|---|---|
| PubChem CID | 107958201 |
| Molecular Formula | C13H7Br4F |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 497.73 |
| IUPAC Name | 1,4-dibromo-2-[bromo-(3-bromo-2-fluorophenyl)methyl]benzene |
| SMILES | Fc1c(Br)cccc1C(Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H7Br4F/c14-7-4-5-10(15)9(6-7)12(17)8-2-1-3-11(16)13(8)18/h1-6,12H |
| InChIKey | UBWNNLGMEQYSTQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|