C12H18ClNO3 — CID 144911088
1-(2-chloro-4,6-dimethylphenyl)-2-nitroethanol;ethane (PubChem CID 144911088) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-2-nitroethanol;ethane.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-2-nitroethanol;ethane |
|---|---|
| PubChem CID | 144911088 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-2-nitroethanol;ethane |
| SMILES | CC.Cc1cc(C)c(C(O)C[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO3.C2H6/c1-6-3-7(2)10(8(11)4-6)9(13)5-12(14)15;1-2/h3-4,9,13H,5H2,1-2H3;1-2H3 |
| InChIKey | RNVFPKZOTREFDE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|