C8H6Cl2INO3 — CID 125467031
(1R)-1-(2,6-dichloro-4-iodophenyl)-2-nitroethanol (PubChem CID 125467031) has the molecular formula C8H6Cl2INO3 and a molecular weight of 361.95 g/mol. Its IUPAC name is (1R)-1-(2,6-dichloro-4-iodophenyl)-2-nitroethanol.
| Compound Name | (1R)-1-(2,6-dichloro-4-iodophenyl)-2-nitroethanol |
|---|---|
| PubChem CID | 125467031 |
| Molecular Formula | C8H6Cl2INO3 |
| Molecular Weight | 361.95 g/mol |
| Exact Mass | 360.88 |
| IUPAC Name | (1R)-1-(2,6-dichloro-4-iodophenyl)-2-nitroethanol |
| SMILES | O=[N+]([O-])C[C@H](O)c1c(Cl)cc(I)cc1Cl |
| InChI | InChI=1S/C8H6Cl2INO3/c9-5-1-4(11)2-6(10)8(5)7(13)3-12(14)15/h1-2,7,13H,3H2/t7-/m0/s1 |
| InChIKey | QAKLLITZUJSRID-ZETCQYMHSA-N |
| XLogP | 2.91 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|