C6HCl2N3O6 — CID 172863590
1,5-dichloro-2,3,4-trinitrobenzene (PubChem CID 172863590) has the molecular formula C6HCl2N3O6 and a molecular weight of 282.00 g/mol. Its IUPAC name is 1,5-dichloro-2,3,4-trinitrobenzene.
| Compound Name | 1,5-dichloro-2,3,4-trinitrobenzene |
|---|---|
| PubChem CID | 172863590 |
| Molecular Formula | C6HCl2N3O6 |
| Molecular Weight | 282.00 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | 1,5-dichloro-2,3,4-trinitrobenzene |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6HCl2N3O6/c7-2-1-3(8)5(10(14)15)6(11(16)17)4(2)9(12)13/h1H |
| InChIKey | ZRLOYOQTTPDVOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.00 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|