C6H5Cl2N3O2 — CID 131861506
4,6-dichloro-2-nitrobenzene-1,3-diamine (PubChem CID 131861506) has the molecular formula C6H5Cl2N3O2 and a molecular weight of 222.03 g/mol. Its IUPAC name is 4,6-dichloro-2-nitrobenzene-1,3-diamine.
| Compound Name | 4,6-dichloro-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 131861506 |
| Molecular Formula | C6H5Cl2N3O2 |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 4,6-dichloro-2-nitrobenzene-1,3-diamine |
| SMILES | Nc1c(Cl)cc(Cl)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5Cl2N3O2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H,9-10H2 |
| InChIKey | KSVLVPQBOWYCMC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|