C6H4Cl2N2O2 — CID 3576459
3,6-dichloro-2-nitroaniline (PubChem CID 3576459) has the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.02 g/mol. Its IUPAC name is 3,6-dichloro-2-nitroaniline.
| Compound Name | 3,6-dichloro-2-nitroaniline |
|---|---|
| PubChem CID | 3576459 |
| Molecular Formula | C6H4Cl2N2O2 |
| Molecular Weight | 207.02 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | 3,6-dichloro-2-nitroaniline |
| SMILES | Nc1c(Cl)ccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-3-1-2-4(8)6(5(3)9)10(11)12/h1-2H,9H2 |
| InChIKey | NBROUKOXRAMATE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.02 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|