C6H4N6O8 — CID 14921108
2,3,5,6-tetranitrobenzene-1,4-diamine (PubChem CID 14921108) has the molecular formula C6H4N6O8 and a molecular weight of 288.13 g/mol. Its IUPAC name is 2,3,5,6-tetranitrobenzene-1,4-diamine.
| Compound Name | 2,3,5,6-tetranitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 14921108 |
| Molecular Formula | C6H4N6O8 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2,3,5,6-tetranitrobenzene-1,4-diamine |
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])c(N)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N6O8/c7-1-3(9(13)14)5(11(17)18)2(8)6(12(19)20)4(1)10(15)16/h7-8H2 |
| InChIKey | HJZDRZYKECDISU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 224.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|