C6H2ClF3N2O2 — CID 18929896
2-chloro-3,4,5-trifluoro-6-nitroaniline (PubChem CID 18929896) has the molecular formula C6H2ClF3N2O2 and a molecular weight of 226.54 g/mol. Its IUPAC name is 2-chloro-3,4,5-trifluoro-6-nitroaniline.
| Compound Name | 2-chloro-3,4,5-trifluoro-6-nitroaniline |
|---|---|
| PubChem CID | 18929896 |
| Molecular Formula | C6H2ClF3N2O2 |
| Molecular Weight | 226.54 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2-chloro-3,4,5-trifluoro-6-nitroaniline |
| SMILES | Nc1c(Cl)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2ClF3N2O2/c7-1-2(8)3(9)4(10)6(5(1)11)12(13)14/h11H2 |
| InChIKey | WTMXFHVXVOWDSG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|