C7H2ClF3N2O4 — CID 23622463
1-chloro-2,3,4-trifluoro-5-nitro-6-(nitromethyl)benzene (PubChem CID 23622463) has the molecular formula C7H2ClF3N2O4 and a molecular weight of 270.55 g/mol. Its IUPAC name is 1-chloro-2,3,4-trifluoro-5-nitro-6-(nitromethyl)benzene.
| Compound Name | 1-chloro-2,3,4-trifluoro-5-nitro-6-(nitromethyl)benzene |
|---|---|
| PubChem CID | 23622463 |
| Molecular Formula | C7H2ClF3N2O4 |
| Molecular Weight | 270.55 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 1-chloro-2,3,4-trifluoro-5-nitro-6-(nitromethyl)benzene |
| SMILES | O=[N+]([O-])Cc1c(Cl)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H2ClF3N2O4/c8-3-2(1-12(14)15)7(13(16)17)6(11)5(10)4(3)9/h1H2 |
| InChIKey | UUFZYEBFCXZMCR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|