C8H4F4N2O4 — CID 18920667
1,2,4,5-tetrafluoro-3,6-bis(nitromethyl)benzene (PubChem CID 18920667) has the molecular formula C8H4F4N2O4 and a molecular weight of 268.12 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(nitromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(nitromethyl)benzene |
|---|---|
| PubChem CID | 18920667 |
| Molecular Formula | C8H4F4N2O4 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(nitromethyl)benzene |
| SMILES | O=[N+]([O-])Cc1c(F)c(F)c(C[N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C8H4F4N2O4/c9-5-3(1-13(15)16)6(10)8(12)4(7(5)11)2-14(17)18/h1-2H2 |
| InChIKey | VZEHXQVWSYUNHS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|