C16H8F10OS — CID 139986963
1,2,3,4,5-pentafluoro-6-[2-[2-(2,3,4,5,6-pentafluorophenyl)ethylsulfinyl]ethyl]benzene (PubChem CID 139986963) has the molecular formula C16H8F10OS and a molecular weight of 438.29 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-[2-(2,3,4,5,6-pentafluorophenyl)ethylsulfinyl]ethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-[2-(2,3,4,5,6-pentafluorophenyl)ethylsulfinyl]ethyl]benzene |
|---|---|
| PubChem CID | 139986963 |
| Molecular Formula | C16H8F10OS |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-[2-(2,3,4,5,6-pentafluorophenyl)ethylsulfinyl]ethyl]benzene |
| SMILES | O=S(CCc1c(F)c(F)c(F)c(F)c1F)CCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H8F10OS/c17-7-5(8(18)12(22)15(25)11(7)21)1-3-28(27)4-2-6-9(19)13(23)16(26)14(24)10(6)20/h1-4H2 |
| InChIKey | VUQVWRLIMXUDRZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|