C11H12ArF6 — CID 158257031
argon;1,2,3,4,5-pentafluoro-6-pentylbenzene;hydrofluoride (PubChem CID 158257031) has the molecular formula C11H12ArF6 and a molecular weight of 298.15 g/mol. Its IUPAC name is argon;1,2,3,4,5-pentafluoro-6-pentylbenzene;hydrofluoride.
| Compound Name | argon;1,2,3,4,5-pentafluoro-6-pentylbenzene;hydrofluoride |
|---|---|
| PubChem CID | 158257031 |
| Molecular Formula | C11H12ArF6 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | argon;1,2,3,4,5-pentafluoro-6-pentylbenzene;hydrofluoride |
| SMILES | CCCCCc1c(F)c(F)c(F)c(F)c1F.F.[Ar] |
| InChI | InChI=1S/C11H11F5.Ar.FH/c1-2-3-4-5-6-7(12)9(14)11(16)10(15)8(6)13;;/h2-5H2,1H3;;1H |
| InChIKey | GHKGFPPXFAMBMY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|