C17H17F4N — CID 15938619
4-(2,3,5,6-tetrafluoro-4-pentylphenyl)aniline (PubChem CID 15938619) has the molecular formula C17H17F4N and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluoro-4-pentylphenyl)aniline.
| Compound Name | 4-(2,3,5,6-tetrafluoro-4-pentylphenyl)aniline |
|---|---|
| PubChem CID | 15938619 |
| Molecular Formula | C17H17F4N |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-(2,3,5,6-tetrafluoro-4-pentylphenyl)aniline |
| SMILES | CCCCCc1c(F)c(F)c(-c2ccc(N)cc2)c(F)c1F |
| InChI | InChI=1S/C17H17F4N/c1-2-3-4-5-12-14(18)16(20)13(17(21)15(12)19)10-6-8-11(22)9-7-10/h6-9H,2-5,22H2,1H3 |
| InChIKey | HOGGJLXXFIPOQO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|