C18H20F4N2 — CID 15001653
[2,3,5,6-tetrafluoro-4-(4-hexylphenyl)phenyl]hydrazine (PubChem CID 15001653) has the molecular formula C18H20F4N2 and a molecular weight of 340.36 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(4-hexylphenyl)phenyl]hydrazine.
| Compound Name | [2,3,5,6-tetrafluoro-4-(4-hexylphenyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 15001653 |
| Molecular Formula | C18H20F4N2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(4-hexylphenyl)phenyl]hydrazine |
| SMILES | CCCCCCc1ccc(-c2c(F)c(F)c(NN)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H20F4N2/c1-2-3-4-5-6-11-7-9-12(10-8-11)13-14(19)16(21)18(24-23)17(22)15(13)20/h7-10,24H,2-6,23H2,1H3 |
| InChIKey | GGSZBKSXJPQGFI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|