C23H17F4NS — CID 170190209
[4-[4-(4-butylphenyl)phenyl]-2,3,5,6-tetrafluorophenyl] thiocyanate (PubChem CID 170190209) has the molecular formula C23H17F4NS and a molecular weight of 415.46 g/mol. Its IUPAC name is [4-[4-(4-butylphenyl)phenyl]-2,3,5,6-tetrafluorophenyl] thiocyanate.
| Compound Name | [4-[4-(4-butylphenyl)phenyl]-2,3,5,6-tetrafluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 170190209 |
| Molecular Formula | C23H17F4NS |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [4-[4-(4-butylphenyl)phenyl]-2,3,5,6-tetrafluorophenyl] thiocyanate |
| SMILES | CCCCc1ccc(-c2ccc(-c3c(F)c(F)c(SC#N)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C23H17F4NS/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-17(12-10-16)18-19(24)21(26)23(29-13-28)22(27)20(18)25/h5-12H,2-4H2,1H3 |
| InChIKey | ULCZCJANQROKES-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|