C25H26O3 — CID 132941130
4,5-bis(4-butylphenyl)cyclopent-4-ene-1,2,3-trione (PubChem CID 132941130) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4,5-bis(4-butylphenyl)cyclopent-4-ene-1,2,3-trione.
| Compound Name | 4,5-bis(4-butylphenyl)cyclopent-4-ene-1,2,3-trione |
|---|---|
| PubChem CID | 132941130 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4,5-bis(4-butylphenyl)cyclopent-4-ene-1,2,3-trione |
| SMILES | CCCCc1ccc(-c2c(-c3ccc(CCCC)cc3)c(=O)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C25H26O3/c1-3-5-7-17-9-13-19(14-10-17)21-22(24(27)25(28)23(21)26)20-15-11-18(12-16-20)8-6-4-2/h9-16H,3-8H2,1-2H3 |
| InChIKey | HYJYRKMLUOIWDQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|