C50H56O2 — CID 101479929
4-[2,6-bis(4-butylphenyl)pyran-4-ylidene]-2,6-bis(4-butylphenyl)pyran (PubChem CID 101479929) has the molecular formula C50H56O2 and a molecular weight of 689.00 g/mol. Its IUPAC name is 4-[2,6-bis(4-butylphenyl)pyran-4-ylidene]-2,6-bis(4-butylphenyl)pyran.
| Compound Name | 4-[2,6-bis(4-butylphenyl)pyran-4-ylidene]-2,6-bis(4-butylphenyl)pyran |
|---|---|
| PubChem CID | 101479929 |
| Molecular Formula | C50H56O2 |
| Molecular Weight | 689.00 g/mol |
| Exact Mass | 688.43 |
| IUPAC Name | 4-[2,6-bis(4-butylphenyl)pyran-4-ylidene]-2,6-bis(4-butylphenyl)pyran |
| SMILES | CCCCc1ccc(C2=CC(=C3C=C(c4ccc(CCCC)cc4)OC(c4ccc(CCCC)cc4)=C3)C=C(c3ccc(CCCC)cc3)O2)cc1 |
| InChI | InChI=1S/C50H56O2/c1-5-9-13-37-17-25-41(26-18-37)47-33-45(34-48(51-47)42-27-19-38(20-28-42)14-10-6-2)46-35-49(43-29-21-39(22-30-43)15-11-7-3)52-50(36-46)44-31-23-40(24-32-44)16-12-8-4/h17-36H,5-16H2,1-4H3 |
| InChIKey | HYRXLDWDRBBCFQ-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.00 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |