C26H19F4NS — CID 170190239
[2,3,5,6-tetrafluoro-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]phenyl] thiocyanate (PubChem CID 170190239) has the molecular formula C26H19F4NS and a molecular weight of 453.50 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]phenyl] thiocyanate.
| Compound Name | [2,3,5,6-tetrafluoro-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 170190239 |
| Molecular Formula | C26H19F4NS |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]phenyl] thiocyanate |
| SMILES | CCCCCc1ccc(-c2ccc(C#Cc3c(F)c(F)c(SC#N)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C26H19F4NS/c1-2-3-4-5-17-6-11-19(12-7-17)20-13-8-18(9-14-20)10-15-21-22(27)24(29)26(32-16-31)25(30)23(21)28/h6-9,11-14H,2-5H2,1H3 |
| InChIKey | VFSVVXXGIUYEEH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|