C18H11F4NS — CID 170190200
[2,3,5,6-tetrafluoro-4-[2-(4-propylphenyl)ethynyl]phenyl] thiocyanate (PubChem CID 170190200) has the molecular formula C18H11F4NS and a molecular weight of 349.35 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-[2-(4-propylphenyl)ethynyl]phenyl] thiocyanate.
| Compound Name | [2,3,5,6-tetrafluoro-4-[2-(4-propylphenyl)ethynyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 170190200 |
| Molecular Formula | C18H11F4NS |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-[2-(4-propylphenyl)ethynyl]phenyl] thiocyanate |
| SMILES | CCCc1ccc(C#Cc2c(F)c(F)c(SC#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H11F4NS/c1-2-3-11-4-6-12(7-5-11)8-9-13-14(19)16(21)18(24-10-23)17(22)15(13)20/h4-7H,2-3H2,1H3 |
| InChIKey | DJAWWNWSWICYQF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|