C25H22F2N2 — CID 135130201
[4-[2-(4-ethyl-2,6-difluorophenyl)ethynyl]phenyl]-(4-propylphenyl)diazene (PubChem CID 135130201) has the molecular formula C25H22F2N2 and a molecular weight of 388.46 g/mol. Its IUPAC name is [4-[2-(4-ethyl-2,6-difluorophenyl)ethynyl]phenyl]-(4-propylphenyl)diazene.
| Compound Name | [4-[2-(4-ethyl-2,6-difluorophenyl)ethynyl]phenyl]-(4-propylphenyl)diazene |
|---|---|
| PubChem CID | 135130201 |
| Molecular Formula | C25H22F2N2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [4-[2-(4-ethyl-2,6-difluorophenyl)ethynyl]phenyl]-(4-propylphenyl)diazene |
| SMILES | CCCc1ccc(/N=N/c2ccc(C#Cc3c(F)cc(CC)cc3F)cc2)cc1 |
| InChI | InChI=1S/C25H22F2N2/c1-3-5-19-6-11-21(12-7-19)28-29-22-13-8-20(9-14-22)10-15-23-24(26)16-18(4-2)17-25(23)27/h6-9,11-14,16-17H,3-5H2,1-2H3/b29-28+ |
| InChIKey | QXFCSFJYLOTACS-ZQHSETAFSA-N |
| XLogP | 7.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|