C26H21F2NS — CID 167217603
[2,6-difluoro-4-[4-[2-(4-pentylphenyl)ethynyl]phenyl]phenyl] thiocyanate (PubChem CID 167217603) has the molecular formula C26H21F2NS and a molecular weight of 417.52 g/mol. Its IUPAC name is [2,6-difluoro-4-[4-[2-(4-pentylphenyl)ethynyl]phenyl]phenyl] thiocyanate.
| Compound Name | [2,6-difluoro-4-[4-[2-(4-pentylphenyl)ethynyl]phenyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 167217603 |
| Molecular Formula | C26H21F2NS |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [2,6-difluoro-4-[4-[2-(4-pentylphenyl)ethynyl]phenyl]phenyl] thiocyanate |
| SMILES | CCCCCc1ccc(C#Cc2ccc(-c3cc(F)c(SC#N)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C26H21F2NS/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-12-14-22(15-13-21)23-16-24(27)26(30-18-29)25(28)17-23/h6-9,12-17H,2-5H2,1H3 |
| InChIKey | OXBARTKDUJKVCG-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|