C22H17F2N — CID 163511133
3-[2,6-difluoro-4-[2-(4-pentylphenyl)ethynyl]phenyl]prop-2-ynenitrile (PubChem CID 163511133) has the molecular formula C22H17F2N and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[2-(4-pentylphenyl)ethynyl]phenyl]prop-2-ynenitrile.
| Compound Name | 3-[2,6-difluoro-4-[2-(4-pentylphenyl)ethynyl]phenyl]prop-2-ynenitrile |
|---|---|
| PubChem CID | 163511133 |
| Molecular Formula | C22H17F2N |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[2,6-difluoro-4-[2-(4-pentylphenyl)ethynyl]phenyl]prop-2-ynenitrile |
| SMILES | CCCCCc1ccc(C#Cc2cc(F)c(C#CC#N)c(F)c2)cc1 |
| InChI | InChI=1S/C22H17F2N/c1-2-3-4-6-17-8-10-18(11-9-17)12-13-19-15-21(23)20(7-5-14-25)22(24)16-19/h8-11,15-16H,2-4,6H2,1H3 |
| InChIKey | DCUKZLHYLRDUHE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|